About 3-methyltetracen-2-amine
3-methyltetracen-2-amine (PubChem CID 154953105) has the molecular formula C19H15N
and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-methyltetracen-2-amine.
Molecular Properties
| Compound Name | 3-methyltetracen-2-amine |
| PubChem CID | 154953105 |
| Molecular Formula | C19H15N |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-methyltetracen-2-amine |
| SMILES | Cc1cc2cc3cc4ccccc4cc3cc2cc1N |
| InChI | InChI=1S/C19H15N/c1-12-6-15-9-16-7-13-4-2-3-5-14(13)8-17(16)10-18(15)11-19(12)20/h2-11H,20H2,1H3 |
| InChIKey | HCIHKDPEPKSAPO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methyltetracen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyltetracen-2-amine?
The IUPAC name of 3-methyltetracen-2-amine (CID 154953105) is 3-methyltetracen-2-amine.
What is the SMILES notation for 3-methyltetracen-2-amine?
The canonical SMILES for 3-methyltetracen-2-amine is Cc1cc2cc3cc4ccccc4cc3cc2cc1N.
What is the InChIKey of 3-methyltetracen-2-amine?
The InChIKey is HCIHKDPEPKSAPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15N/c1-12-6-15-9-16-7-13-4-2-3-5-14(13)8-17(16)10-18(15)11-19(12)20/h2-11H,20H2,1H3.
What are the key properties of 3-methyltetracen-2-amine?
3-methyltetracen-2-amine has a molecular weight of 257.34 g/mol, XLogP of 5.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyltetracen-2-amine is sourced from PubChem (CID 154953105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).