About tetracene-2,3-diamine
tetracene-2,3-diamine (PubChem CID 101108854) has the molecular formula C18H14N2
and a molecular weight of 258.32 g/mol. Its IUPAC name is tetracene-2,3-diamine.
Molecular Properties
| Compound Name | tetracene-2,3-diamine |
| PubChem CID | 101108854 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | tetracene-2,3-diamine |
| SMILES | Nc1cc2cc3cc4ccccc4cc3cc2cc1N |
| InChI | InChI=1S/C18H14N2/c19-17-9-15-7-13-5-11-3-1-2-4-12(11)6-14(13)8-16(15)10-18(17)20/h1-10H,19-20H2 |
| InChIKey | YFJZNWYBAKRYHV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze tetracene-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetracene-2,3-diamine?
The IUPAC name of tetracene-2,3-diamine (CID 101108854) is tetracene-2,3-diamine.
What is the SMILES notation for tetracene-2,3-diamine?
The canonical SMILES for tetracene-2,3-diamine is Nc1cc2cc3cc4ccccc4cc3cc2cc1N.
What is the InChIKey of tetracene-2,3-diamine?
The InChIKey is YFJZNWYBAKRYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2/c19-17-9-15-7-13-5-11-3-1-2-4-12(11)6-14(13)8-16(15)10-18(17)20/h1-10H,19-20H2.
What are the key properties of tetracene-2,3-diamine?
tetracene-2,3-diamine has a molecular weight of 258.32 g/mol, XLogP of 4.31, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tetracene-2,3-diamine is sourced from PubChem (CID 101108854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).