About anthracene;benzene-1,2-diamine;ethene
anthracene;benzene-1,2-diamine;ethene (PubChem CID 161334010) has the molecular formula C22H22N2
and a molecular weight of 314.43 g/mol. Its IUPAC name is anthracene;benzene-1,2-diamine;ethene.
Molecular Properties
| Compound Name | anthracene;benzene-1,2-diamine;ethene |
| PubChem CID | 161334010 |
| Molecular Formula | C22H22N2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | anthracene;benzene-1,2-diamine;ethene |
| SMILES | C=C.Nc1ccccc1N.c1ccc2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C14H10.C6H8N2.C2H4/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-5-3-1-2-4-6(5)8;1-2/h1-10H;1-4H,7-8H2;1-2H2 |
| InChIKey | VLUFZHJQQCVSBZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze anthracene;benzene-1,2-diamine;ethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene;benzene-1,2-diamine;ethene?
The IUPAC name of anthracene;benzene-1,2-diamine;ethene (CID 161334010) is anthracene;benzene-1,2-diamine;ethene.
What is the SMILES notation for anthracene;benzene-1,2-diamine;ethene?
The canonical SMILES for anthracene;benzene-1,2-diamine;ethene is C=C.Nc1ccccc1N.c1ccc2cc3ccccc3cc2c1.
What is the InChIKey of anthracene;benzene-1,2-diamine;ethene?
The InChIKey is VLUFZHJQQCVSBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C6H8N2.C2H4/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1;7-5-3-1-2-4-6(5)8;1-2/h1-10H;1-4H,7-8H2;1-2H2.
What are the key properties of anthracene;benzene-1,2-diamine;ethene?
anthracene;benzene-1,2-diamine;ethene has a molecular weight of 314.43 g/mol, XLogP of 5.65, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene;benzene-1,2-diamine;ethene is sourced from PubChem (CID 161334010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).