About ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene
ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene (PubChem CID 162748725) has the molecular formula C29H39N
and a molecular weight of 401.64 g/mol. Its IUPAC name is ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene.
Molecular Properties
| Compound Name | ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene |
| PubChem CID | 162748725 |
| Molecular Formula | C29H39N |
| Molecular Weight | 401.64 g/mol |
| Exact Mass | 401.31 |
| IUPAC Name | ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene |
| SMILES | CC.CC.Cc1cc2ccccc2cc1N.Cc1ccc2cc(C(C)C)ccc2c1 |
| InChI | InChI=1S/C14H16.C11H11N.2C2H6/c1-10(2)12-6-7-13-8-11(3)4-5-14(13)9-12;1-8-6-9-4-2-3-5-10(9)7-11(8)12;2*1-2/h4-10H,1-3H3;2-7H,12H2,1H3;2*1-2H3 |
| InChIKey | NEDMMVKGUUUGFD-UHFFFAOYSA-N |
| XLogP | 9.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.64 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene?
The IUPAC name of ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene (CID 162748725) is ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene.
What is the SMILES notation for ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene?
The canonical SMILES for ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene is CC.CC.Cc1cc2ccccc2cc1N.Cc1ccc2cc(C(C)C)ccc2c1.
What is the InChIKey of ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene?
The InChIKey is NEDMMVKGUUUGFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16.C11H11N.2C2H6/c1-10(2)12-6-7-13-8-11(3)4-5-14(13)9-12;1-8-6-9-4-2-3-5-10(9)7-11(8)12;2*1-2/h4-10H,1-3H3;2-7H,12H2,1H3;2*1-2H3.
What are the key properties of ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene?
ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene has a molecular weight of 401.64 g/mol, XLogP of 9.05, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylnaphthalen-2-amine;2-methyl-6-propan-2-ylnaphthalene is sourced from PubChem (CID 162748725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).