C15H17Cl2N3 — CID 23616360
2,7-dimethylacridine-3,6-diamine;dihydrochloride (PubChem CID 23616360) has the molecular formula C15H17Cl2N3 and a molecular weight of 310.23 g/mol. Its IUPAC name is 2,7-dimethylacridine-3,6-diamine;dihydrochloride.
| Compound Name | 2,7-dimethylacridine-3,6-diamine;dihydrochloride |
|---|---|
| PubChem CID | 23616360 |
| Molecular Formula | C15H17Cl2N3 |
| Molecular Weight | 310.23 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | 2,7-dimethylacridine-3,6-diamine;dihydrochloride |
| SMILES | Cc1cc2cc3cc(C)c(N)cc3nc2cc1N.Cl.Cl |
| InChI | InChI=1S/C15H15N3.2ClH/c1-8-3-10-5-11-4-9(2)13(17)7-15(11)18-14(10)6-12(8)16;;/h3-7H,16-17H2,1-2H3;2*1H |
| InChIKey | MAYXRPLMFZUAPG-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|