C14H26N2S — CID 144533548
4,7-dimethyl-2,1,3-benzothiadiazole;ethane (PubChem CID 144533548) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 4,7-dimethyl-2,1,3-benzothiadiazole;ethane.
| Compound Name | 4,7-dimethyl-2,1,3-benzothiadiazole;ethane |
|---|---|
| PubChem CID | 144533548 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 4,7-dimethyl-2,1,3-benzothiadiazole;ethane |
| SMILES | CC.CC.CC.Cc1ccc(C)c2nsnc12 |
| InChI | InChI=1S/C8H8N2S.3C2H6/c1-5-3-4-6(2)8-7(5)9-11-10-8;3*1-2/h3-4H,1-2H3;3*1-2H3 |
| InChIKey | XZHRYXOJHRTFGK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |