C14H24N2 — CID 142256596
5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1H-pyrrol-2-amine;ethane (PubChem CID 142256596) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1H-pyrrol-2-amine;ethane.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1H-pyrrol-2-amine;ethane |
|---|---|
| PubChem CID | 142256596 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-4-ethenyl-1H-pyrrol-2-amine;ethane |
| SMILES | C=C/C=C\c1[nH]c(N)cc1C=C.CC.CC |
| InChI | InChI=1S/C10H12N2.2C2H6/c1-3-5-6-9-8(4-2)7-10(11)12-9;2*1-2/h3-7,12H,1-2,11H2;2*1-2H3/b6-5-;; |
| InChIKey | DSKOHBCOOZGOKG-XNOMRPDFSA-N |
| XLogP | 4.49 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|