C16H19N — CID 130271448
3-[(1Z)-buta-1,3-dienyl]-2-ethenyl-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrole (PubChem CID 130271448) has the molecular formula C16H19N and a molecular weight of 225.33 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-2-ethenyl-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrole.
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-2-ethenyl-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrole |
|---|---|
| PubChem CID | 130271448 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-2-ethenyl-4,5-bis[(Z)-prop-1-enyl]-1H-pyrrole |
| SMILES | C=C/C=C\c1c(C=C)[nH]c(/C=C\C)c1/C=C\C |
| InChI | InChI=1S/C16H19N/c1-5-9-12-14-13(10-6-2)16(11-7-3)17-15(14)8-4/h5-12,17H,1,4H2,2-3H3/b10-6-,11-7-,12-9- |
| InChIKey | CUYOYRXTMPIYMB-KAFDAXIMSA-N |
| XLogP | 4.92 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|