C15H19NO2 — CID 134267282
6-[(1Z)-buta-1,3-dienyl]-3-tert-butyl-5-ethenyl-4-hydroxy-1H-pyridin-2-one (PubChem CID 134267282) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is 6-[(1Z)-buta-1,3-dienyl]-3-tert-butyl-5-ethenyl-4-hydroxy-1H-pyridin-2-one.
| Compound Name | 6-[(1Z)-buta-1,3-dienyl]-3-tert-butyl-5-ethenyl-4-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 134267282 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 6-[(1Z)-buta-1,3-dienyl]-3-tert-butyl-5-ethenyl-4-hydroxy-1H-pyridin-2-one |
| SMILES | C=C/C=C\c1[nH]c(=O)c(C(C)(C)C)c(O)c1C=C |
| InChI | InChI=1S/C15H19NO2/c1-6-8-9-11-10(7-2)13(17)12(14(18)16-11)15(3,4)5/h6-9H,1-2H2,3-5H3,(H2,16,17,18)/b9-8- |
| InChIKey | UTRNTLDAWVVAKK-HJWRWDBZSA-N |
| XLogP | 3.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|