C18H19NO — CID 170097280
3,5-bis[(1Z)-buta-1,3-dienyl]-2,6-bis(ethenyl)-1-methylpyridin-4-one (PubChem CID 170097280) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is 3,5-bis[(1Z)-buta-1,3-dienyl]-2,6-bis(ethenyl)-1-methylpyridin-4-one.
| Compound Name | 3,5-bis[(1Z)-buta-1,3-dienyl]-2,6-bis(ethenyl)-1-methylpyridin-4-one |
|---|---|
| PubChem CID | 170097280 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 3,5-bis[(1Z)-buta-1,3-dienyl]-2,6-bis(ethenyl)-1-methylpyridin-4-one |
| SMILES | C=C/C=C\c1c(C=C)n(C)c(C=C)c(/C=C\C=C)c1=O |
| InChI | InChI=1S/C18H19NO/c1-6-10-12-14-16(8-3)19(5)17(9-4)15(18(14)20)13-11-7-2/h6-13H,1-4H2,5H3/b12-10-,13-11- |
| InChIKey | MLYSBSFSTYXMSS-MIMPSMLTSA-N |
| XLogP | 4.07 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|