C14H17N — CID 174312838
(5E)-3-[(1Z)-buta-1,3-dienyl]-1,2-dimethyl-4-methylidene-5-prop-2-enylidenepyrrole (PubChem CID 174312838) has the molecular formula C14H17N and a molecular weight of 199.30 g/mol. Its IUPAC name is (5E)-3-[(1Z)-buta-1,3-dienyl]-1,2-dimethyl-4-methylidene-5-prop-2-enylidenepyrrole.
| Compound Name | (5E)-3-[(1Z)-buta-1,3-dienyl]-1,2-dimethyl-4-methylidene-5-prop-2-enylidenepyrrole |
|---|---|
| PubChem CID | 174312838 |
| Molecular Formula | C14H17N |
| Molecular Weight | 199.30 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | (5E)-3-[(1Z)-buta-1,3-dienyl]-1,2-dimethyl-4-methylidene-5-prop-2-enylidenepyrrole |
| SMILES | C=C/C=C\c1c(C)n(C)/c(=C/C=C)c1=C |
| InChI | InChI=1S/C14H17N/c1-6-8-10-13-11(3)14(9-7-2)15(5)12(13)4/h6-10H,1-3H2,4-5H3/b10-8-,14-9+ |
| InChIKey | ZITNSHDGPLRMIF-YYTLBARXSA-N |
| XLogP | 1.91 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|