C13H24N2O — CID 170584142
4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-imidazol-2-one;ethane (PubChem CID 170584142) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-imidazol-2-one;ethane.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-imidazol-2-one;ethane |
|---|---|
| PubChem CID | 170584142 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-1H-imidazol-2-one;ethane |
| SMILES | C=C/C=C\c1c(C)[nH]c(=O)n1C.CC.CC |
| InChI | InChI=1S/C9H12N2O.2C2H6/c1-4-5-6-8-7(2)10-9(12)11(8)3;2*1-2/h4-6H,1H2,2-3H3,(H,10,12);2*1-2H3/b6-5-;; |
| InChIKey | DYPYANVCXSMXPW-XNOMRPDFSA-N |
| XLogP | 3.27 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|