C11H18N2 — CID 143037368
4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1H-imidazole;ethane (PubChem CID 143037368) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1H-imidazole;ethane.
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1H-imidazole;ethane |
|---|---|
| PubChem CID | 143037368 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-2,5-dimethyl-1H-imidazole;ethane |
| SMILES | C=C/C=C\c1nc(C)[nH]c1C.CC |
| InChI | InChI=1S/C9H12N2.C2H6/c1-4-5-6-9-7(2)10-8(3)11-9;1-2/h4-6H,1H2,2-3H3,(H,10,11);1-2H3/b6-5-; |
| InChIKey | NKYZKMVBENEKNK-YSMBQZINSA-N |
| XLogP | 3.25 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|