C12H13N3O — CID 143245837
3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-5-methyl-1,2-oxazole (PubChem CID 143245837) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is 3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-5-methyl-1,2-oxazole.
| Compound Name | 3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-5-methyl-1,2-oxazole |
|---|---|
| PubChem CID | 143245837 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-5-methyl-1,2-oxazole |
| SMILES | C=C/C=C\c1nc(-c2cc(C)on2)[nH]c1C |
| InChI | InChI=1S/C12H13N3O/c1-4-5-6-10-9(3)13-12(14-10)11-7-8(2)16-15-11/h4-7H,1H2,2-3H3,(H,13,14)/b6-5- |
| InChIKey | GBRPLISCPSYMHI-WAYWQWQTSA-N |
| XLogP | 2.88 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|