About 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole
5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole (PubChem CID 59259265) has the molecular formula C8H8N2OS
and a molecular weight of 180.23 g/mol. Its IUPAC name is 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole.
Analyze 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole?
The IUPAC name of 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole (CID 59259265) is 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole.
What is the SMILES notation for 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole?
The canonical SMILES for 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole is Cc1csc(-c2cc(C)on2)n1.
What is the InChIKey of 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole?
The InChIKey is SODLOWJWVSVMHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2OS/c1-5-4-12-8(9-5)7-3-6(2)11-10-7/h3-4H,1-2H3.
What are the key properties of 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole?
5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole has a molecular weight of 180.23 g/mol, XLogP of 2.41, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-(4-methyl-1,3-thiazol-2-yl)-1,2-oxazole is sourced from PubChem (CID 59259265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).