C13H10FNO — CID 101268733
5-[(1E)-buta-1,3-dienyl]-3-(4-fluorophenyl)-1,2-oxazole (PubChem CID 101268733) has the molecular formula C13H10FNO and a molecular weight of 215.23 g/mol. Its IUPAC name is 5-[(1E)-buta-1,3-dienyl]-3-(4-fluorophenyl)-1,2-oxazole.
| Compound Name | 5-[(1E)-buta-1,3-dienyl]-3-(4-fluorophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 101268733 |
| Molecular Formula | C13H10FNO |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 5-[(1E)-buta-1,3-dienyl]-3-(4-fluorophenyl)-1,2-oxazole |
| SMILES | C=C/C=C/c1cc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C13H10FNO/c1-2-3-4-12-9-13(15-16-12)10-5-7-11(14)8-6-10/h2-9H,1H2/b4-3+ |
| InChIKey | CHUPQOQPDKWIAT-ONEGZZNKSA-N |
| XLogP | 3.68 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|