C15H10FNO2 — CID 135604711
4-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]phenol (PubChem CID 135604711) has the molecular formula C15H10FNO2 and a molecular weight of 255.25 g/mol. Its IUPAC name is 4-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]phenol.
| Compound Name | 4-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]phenol |
|---|---|
| PubChem CID | 135604711 |
| Molecular Formula | C15H10FNO2 |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 4-[3-(4-fluorophenyl)-1,2-oxazol-5-yl]phenol |
| SMILES | Oc1ccc(-c2cc(-c3ccc(F)cc3)no2)cc1 |
| InChI | InChI=1S/C15H10FNO2/c16-12-5-1-10(2-6-12)14-9-15(19-17-14)11-3-7-13(18)8-4-11/h1-9,18H |
| InChIKey | IZOQMYKBFRVXNF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |