About 4-fluorophenol;dihydrofluoride
4-fluorophenol;dihydrofluoride (PubChem CID 174753793) has the molecular formula C6H7F3O
and a molecular weight of 152.11 g/mol. Its IUPAC name is 4-fluorophenol;dihydrofluoride.
Molecular Properties
| Compound Name | 4-fluorophenol;dihydrofluoride |
| PubChem CID | 174753793 |
| Molecular Formula | C6H7F3O |
| Molecular Weight | 152.11 g/mol |
| Exact Mass | 152.04 |
| IUPAC Name | 4-fluorophenol;dihydrofluoride |
| SMILES | F.F.Oc1ccc(F)cc1 |
| InChI | InChI=1S/C6H5FO.2FH/c7-5-1-3-6(8)4-2-5;;/h1-4,8H;2*1H |
| InChIKey | CRKOQUXUKURSMV-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.11 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-fluorophenol;dihydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorophenol;dihydrofluoride?
The IUPAC name of 4-fluorophenol;dihydrofluoride (CID 174753793) is 4-fluorophenol;dihydrofluoride.
What is the SMILES notation for 4-fluorophenol;dihydrofluoride?
The canonical SMILES for 4-fluorophenol;dihydrofluoride is F.F.Oc1ccc(F)cc1.
What is the InChIKey of 4-fluorophenol;dihydrofluoride?
The InChIKey is CRKOQUXUKURSMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO.2FH/c7-5-1-3-6(8)4-2-5;;/h1-4,8H;2*1H.
What are the key properties of 4-fluorophenol;dihydrofluoride?
4-fluorophenol;dihydrofluoride has a molecular weight of 152.11 g/mol, XLogP of 1.84, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorophenol;dihydrofluoride is sourced from PubChem (CID 174753793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).