About carbamic acid;4-fluorophenol
carbamic acid;4-fluorophenol (PubChem CID 67037635) has the molecular formula C7H8FNO3
and a molecular weight of 173.14 g/mol. Its IUPAC name is carbamic acid;4-fluorophenol.
Molecular Properties
| Compound Name | carbamic acid;4-fluorophenol |
| PubChem CID | 67037635 |
| Molecular Formula | C7H8FNO3 |
| Molecular Weight | 173.14 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | carbamic acid;4-fluorophenol |
| SMILES | NC(=O)O.Oc1ccc(F)cc1 |
| InChI | InChI=1S/C6H5FO.CH3NO2/c7-5-1-3-6(8)4-2-5;2-1(3)4/h1-4,8H;2H2,(H,3,4) |
| InChIKey | KEKXYCWVAFFEKY-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.14 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze carbamic acid;4-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;4-fluorophenol?
The IUPAC name of carbamic acid;4-fluorophenol (CID 67037635) is carbamic acid;4-fluorophenol.
What is the SMILES notation for carbamic acid;4-fluorophenol?
The canonical SMILES for carbamic acid;4-fluorophenol is NC(=O)O.Oc1ccc(F)cc1.
What is the InChIKey of carbamic acid;4-fluorophenol?
The InChIKey is KEKXYCWVAFFEKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO.CH3NO2/c7-5-1-3-6(8)4-2-5;2-1(3)4/h1-4,8H;2H2,(H,3,4).
What are the key properties of carbamic acid;4-fluorophenol?
carbamic acid;4-fluorophenol has a molecular weight of 173.14 g/mol, XLogP of 1.15, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;4-fluorophenol is sourced from PubChem (CID 67037635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).