About 4-fluorophenol;hydroxylamine;molecular hydrogen
4-fluorophenol;hydroxylamine;molecular hydrogen (PubChem CID 153362949) has the molecular formula C6H10FNO2
and a molecular weight of 147.15 g/mol. Its IUPAC name is 4-fluorophenol;hydroxylamine;molecular hydrogen.
Molecular Properties
| Compound Name | 4-fluorophenol;hydroxylamine;molecular hydrogen |
| PubChem CID | 153362949 |
| Molecular Formula | C6H10FNO2 |
| Molecular Weight | 147.15 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | 4-fluorophenol;hydroxylamine;molecular hydrogen |
| SMILES | NO.Oc1ccc(F)cc1.[H][H] |
| InChI | InChI=1S/C6H5FO.H3NO.H2/c7-5-1-3-6(8)4-2-5;1-2;/h1-4,8H;2H,1H2;1H |
| InChIKey | HXYZNDRUCFDOSO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.15 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorophenol;hydroxylamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorophenol;hydroxylamine;molecular hydrogen?
The IUPAC name of 4-fluorophenol;hydroxylamine;molecular hydrogen (CID 153362949) is 4-fluorophenol;hydroxylamine;molecular hydrogen.
What is the SMILES notation for 4-fluorophenol;hydroxylamine;molecular hydrogen?
The canonical SMILES for 4-fluorophenol;hydroxylamine;molecular hydrogen is NO.Oc1ccc(F)cc1.[H][H].
What is the InChIKey of 4-fluorophenol;hydroxylamine;molecular hydrogen?
The InChIKey is HXYZNDRUCFDOSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO.H3NO.H2/c7-5-1-3-6(8)4-2-5;1-2;/h1-4,8H;2H,1H2;1H.
What are the key properties of 4-fluorophenol;hydroxylamine;molecular hydrogen?
4-fluorophenol;hydroxylamine;molecular hydrogen has a molecular weight of 147.15 g/mol, XLogP of 1.11, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorophenol;hydroxylamine;molecular hydrogen is sourced from PubChem (CID 153362949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).