4-fluorophenol;hydroxylamine;molecular hydrogen

C6H10FNO2 — CID 153362949

IUPAC4-fluorophenol;hydroxylamine;molecular hydrogen
SMILESNO.Oc1ccc(F)cc1.[H][H]
InChIInChI=1S/C6H5FO.H3NO.H2/c7-5-1-3-6(8)4-2-5;1-2;/h1-4,8H;2H,1H2;1H
InChIKeyHXYZNDRUCFDOSO-UHFFFAOYSA-N
MW147.15 g/mol
LogP1.11
Rot. Bonds

About 4-fluorophenol;hydroxylamine;molecular hydrogen

4-fluorophenol;hydroxylamine;molecular hydrogen (PubChem CID 153362949) has the molecular formula C6H10FNO2 and a molecular weight of 147.15 g/mol. Its IUPAC name is 4-fluorophenol;hydroxylamine;molecular hydrogen.

Molecular Properties

Compound Name4-fluorophenol;hydroxylamine;molecular hydrogen
PubChem CID153362949
Molecular FormulaC6H10FNO2
Molecular Weight147.15 g/mol
Exact Mass147.07
IUPAC Name4-fluorophenol;hydroxylamine;molecular hydrogen
SMILESNO.Oc1ccc(F)cc1.[H][H]
InChIInChI=1S/C6H5FO.H3NO.H2/c7-5-1-3-6(8)4-2-5;1-2;/h1-4,8H;2H,1H2;1H
InChIKeyHXYZNDRUCFDOSO-UHFFFAOYSA-N
XLogP1.11
TPSA66.48 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.15
LogP ≤ 51.11
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 4-fluorophenol;hydroxylamine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluorophenol;hydroxylamine;molecular hydrogen?
The IUPAC name of 4-fluorophenol;hydroxylamine;molecular hydrogen (CID 153362949) is 4-fluorophenol;hydroxylamine;molecular hydrogen.
What is the SMILES notation for 4-fluorophenol;hydroxylamine;molecular hydrogen?
The canonical SMILES for 4-fluorophenol;hydroxylamine;molecular hydrogen is NO.Oc1ccc(F)cc1.[H][H].
What is the InChIKey of 4-fluorophenol;hydroxylamine;molecular hydrogen?
The InChIKey is HXYZNDRUCFDOSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5FO.H3NO.H2/c7-5-1-3-6(8)4-2-5;1-2;/h1-4,8H;2H,1H2;1H.
What are the key properties of 4-fluorophenol;hydroxylamine;molecular hydrogen?
4-fluorophenol;hydroxylamine;molecular hydrogen has a molecular weight of 147.15 g/mol, XLogP of 1.11, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorophenol;hydroxylamine;molecular hydrogen is sourced from PubChem (CID 153362949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).