C15H12BNO4 — CID 136633818
[4-[5-(4-hydroxyphenyl)-1,2-oxazol-3-yl]phenyl]boronic acid (PubChem CID 136633818) has the molecular formula C15H12BNO4 and a molecular weight of 281.08 g/mol. Its IUPAC name is [4-[5-(4-hydroxyphenyl)-1,2-oxazol-3-yl]phenyl]boronic acid.
| Compound Name | [4-[5-(4-hydroxyphenyl)-1,2-oxazol-3-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 136633818 |
| Molecular Formula | C15H12BNO4 |
| Molecular Weight | 281.08 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | [4-[5-(4-hydroxyphenyl)-1,2-oxazol-3-yl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-c2cc(-c3ccc(O)cc3)on2)cc1 |
| InChI | InChI=1S/C15H12BNO4/c18-13-7-3-11(4-8-13)15-9-14(17-21-15)10-1-5-12(6-2-10)16(19)20/h1-9,18-20H |
| InChIKey | DBDMYBJZGVZLNU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.08 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|