C14H13NO2 — CID 154926167
(E)-1-(3-phenyl-1,2-oxazol-5-yl)pent-1-en-3-one (PubChem CID 154926167) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is (E)-1-(3-phenyl-1,2-oxazol-5-yl)pent-1-en-3-one.
| Compound Name | (E)-1-(3-phenyl-1,2-oxazol-5-yl)pent-1-en-3-one |
|---|---|
| PubChem CID | 154926167 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | (E)-1-(3-phenyl-1,2-oxazol-5-yl)pent-1-en-3-one |
| SMILES | CCC(=O)/C=C/c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C14H13NO2/c1-2-12(16)8-9-13-10-14(15-17-13)11-6-4-3-5-7-11/h3-10H,2H2,1H3/b9-8+ |
| InChIKey | JBICAXCVPIYVAQ-CMDGGOBGSA-N |
| XLogP | 3.33 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|