C16H13NO4 — CID 101105045
(3E)-5-acetyl-3-[(3-phenyl-1,2-oxazol-5-yl)methylidene]oxolan-2-one (PubChem CID 101105045) has the molecular formula C16H13NO4 and a molecular weight of 283.28 g/mol. Its IUPAC name is (3E)-5-acetyl-3-[(3-phenyl-1,2-oxazol-5-yl)methylidene]oxolan-2-one.
| Compound Name | (3E)-5-acetyl-3-[(3-phenyl-1,2-oxazol-5-yl)methylidene]oxolan-2-one |
|---|---|
| PubChem CID | 101105045 |
| Molecular Formula | C16H13NO4 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | (3E)-5-acetyl-3-[(3-phenyl-1,2-oxazol-5-yl)methylidene]oxolan-2-one |
| SMILES | CC(=O)C1C/C(=C\c2cc(-c3ccccc3)no2)C(=O)O1 |
| InChI | InChI=1S/C16H13NO4/c1-10(18)15-8-12(16(19)20-15)7-13-9-14(17-21-13)11-5-3-2-4-6-11/h2-7,9,15H,8H2,1H3/b12-7+ |
| InChIKey | QOASPSFDKFDQCW-KPKJPENVSA-N |
| XLogP | 2.63 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|