C16H15NO3 — CID 134970913
6-methyl-3-methylidene-4-(3-phenyl-1,2-oxazol-5-yl)oxan-2-one (PubChem CID 134970913) has the molecular formula C16H15NO3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 6-methyl-3-methylidene-4-(3-phenyl-1,2-oxazol-5-yl)oxan-2-one.
| Compound Name | 6-methyl-3-methylidene-4-(3-phenyl-1,2-oxazol-5-yl)oxan-2-one |
|---|---|
| PubChem CID | 134970913 |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 6-methyl-3-methylidene-4-(3-phenyl-1,2-oxazol-5-yl)oxan-2-one |
| SMILES | C=C1C(=O)OC(C)CC1c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C16H15NO3/c1-10-8-13(11(2)16(18)19-10)15-9-14(17-20-15)12-6-4-3-5-7-12/h3-7,9-10,13H,2,8H2,1H3 |
| InChIKey | UNIRKMNRPWBMTR-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|