C20H18N2O2S — CID 41083030
(3S,5S)-3-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-5-methyloxolan-2-one (PubChem CID 41083030) has the molecular formula C20H18N2O2S and a molecular weight of 350.44 g/mol. Its IUPAC name is (3S,5S)-3-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-5-methyloxolan-2-one.
| Compound Name | (3S,5S)-3-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-5-methyloxolan-2-one |
|---|---|
| PubChem CID | 41083030 |
| Molecular Formula | C20H18N2O2S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (3S,5S)-3-[(4,5-diphenyl-1H-imidazol-2-yl)sulfanyl]-5-methyloxolan-2-one |
| SMILES | C[C@H]1C[C@H](Sc2nc(-c3ccccc3)c(-c3ccccc3)[nH]2)C(=O)O1 |
| InChI | InChI=1S/C20H18N2O2S/c1-13-12-16(19(23)24-13)25-20-21-17(14-8-4-2-5-9-14)18(22-20)15-10-6-3-7-11-15/h2-11,13,16H,12H2,1H3,(H,21,22)/t13-,16-/m0/s1 |
| InChIKey | OWNGVZAFGPRPBY-BBRMVZONSA-N |
| XLogP | 4.54 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |