C16H17N3O2S — CID 136675127
5-methyl-2-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]sulfanyl-4-phenyl-1H-pyrimidin-6-one (PubChem CID 136675127) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 5-methyl-2-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]sulfanyl-4-phenyl-1H-pyrimidin-6-one.
| Compound Name | 5-methyl-2-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]sulfanyl-4-phenyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136675127 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 5-methyl-2-[(3R)-1-methyl-2-oxopyrrolidin-3-yl]sulfanyl-4-phenyl-1H-pyrimidin-6-one |
| SMILES | Cc1c(-c2ccccc2)nc(S[C@@H]2CCN(C)C2=O)[nH]c1=O |
| InChI | InChI=1S/C16H17N3O2S/c1-10-13(11-6-4-3-5-7-11)17-16(18-14(10)20)22-12-8-9-19(2)15(12)21/h3-7,12H,8-9H2,1-2H3,(H,17,18,20)/t12-/m1/s1 |
| InChIKey | SQAIMKRTRAFLSS-GFCCVEGCSA-N |
| XLogP | 2.07 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |