C18H22N2OS2 — CID 135439578
2-cyclohexylsulfanyl-5-methyl-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one (PubChem CID 135439578) has the molecular formula C18H22N2OS2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-5-methyl-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-cyclohexylsulfanyl-5-methyl-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135439578 |
| Molecular Formula | C18H22N2OS2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 2-cyclohexylsulfanyl-5-methyl-4-(phenylsulfanylmethyl)-1H-pyrimidin-6-one |
| SMILES | Cc1c(CSc2ccccc2)nc(SC2CCCCC2)[nH]c1=O |
| InChI | InChI=1S/C18H22N2OS2/c1-13-16(12-22-14-8-4-2-5-9-14)19-18(20-17(13)21)23-15-10-6-3-7-11-15/h2,4-5,8-9,15H,3,6-7,10-12H2,1H3,(H,19,20,21) |
| InChIKey | QMPHQTSJSQLBAG-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |