C21H26N2O2S — CID 166606495
4-(2-cyclohexylethyl)-5-methyl-2-phenacylsulfanyl-1H-pyrimidin-6-one (PubChem CID 166606495) has the molecular formula C21H26N2O2S and a molecular weight of 370.52 g/mol. Its IUPAC name is 4-(2-cyclohexylethyl)-5-methyl-2-phenacylsulfanyl-1H-pyrimidin-6-one.
| Compound Name | 4-(2-cyclohexylethyl)-5-methyl-2-phenacylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 166606495 |
| Molecular Formula | C21H26N2O2S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 4-(2-cyclohexylethyl)-5-methyl-2-phenacylsulfanyl-1H-pyrimidin-6-one |
| SMILES | Cc1c(CCC2CCCCC2)nc(SCC(=O)c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C21H26N2O2S/c1-15-18(13-12-16-8-4-2-5-9-16)22-21(23-20(15)25)26-14-19(24)17-10-6-3-7-11-17/h3,6-7,10-11,16H,2,4-5,8-9,12-14H2,1H3,(H,22,23,25) |
| InChIKey | CVPQVQFSKWFHLW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |