C22H29N3O2S — CID 135927540
3-(2-benzylsulfanyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-cyclohexyl-N-methylpropanamide (PubChem CID 135927540) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 3-(2-benzylsulfanyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-cyclohexyl-N-methylpropanamide.
| Compound Name | 3-(2-benzylsulfanyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-cyclohexyl-N-methylpropanamide |
|---|---|
| PubChem CID | 135927540 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 3-(2-benzylsulfanyl-4-methyl-6-oxo-1H-pyrimidin-5-yl)-N-cyclohexyl-N-methylpropanamide |
| SMILES | Cc1nc(SCc2ccccc2)[nH]c(=O)c1CCC(=O)N(C)C1CCCCC1 |
| InChI | InChI=1S/C22H29N3O2S/c1-16-19(13-14-20(26)25(2)18-11-7-4-8-12-18)21(27)24-22(23-16)28-15-17-9-5-3-6-10-17/h3,5-6,9-10,18H,4,7-8,11-15H2,1-2H3,(H,23,24,27) |
| InChIKey | WTFSGGRXUFVQGD-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |