C16H14FNO3 — CID 134970919
4-[3-(2-fluorophenyl)-1,2-oxazol-5-yl]-6-methyl-3-methylideneoxan-2-one (PubChem CID 134970919) has the molecular formula C16H14FNO3 and a molecular weight of 287.29 g/mol. Its IUPAC name is 4-[3-(2-fluorophenyl)-1,2-oxazol-5-yl]-6-methyl-3-methylideneoxan-2-one.
| Compound Name | 4-[3-(2-fluorophenyl)-1,2-oxazol-5-yl]-6-methyl-3-methylideneoxan-2-one |
|---|---|
| PubChem CID | 134970919 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 4-[3-(2-fluorophenyl)-1,2-oxazol-5-yl]-6-methyl-3-methylideneoxan-2-one |
| SMILES | C=C1C(=O)OC(C)CC1c1cc(-c2ccccc2F)no1 |
| InChI | InChI=1S/C16H14FNO3/c1-9-7-12(10(2)16(19)20-9)15-8-14(18-21-15)11-5-3-4-6-13(11)17/h3-6,8-9,12H,2,7H2,1H3 |
| InChIKey | QACAYAWXPNEHPX-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|