About N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide
N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide (PubChem CID 130347890) has the molecular formula C16H13FN2O2
and a molecular weight of 284.29 g/mol. Its IUPAC name is N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide |
| PubChem CID | 130347890 |
| Molecular Formula | C16H13FN2O2 |
| Molecular Weight | 284.29 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide |
| SMILES | O=C(NCc1cc(-c2ccccc2F)no1)C1C=CC=C1 |
| InChI | InChI=1S/C16H13FN2O2/c17-14-8-4-3-7-13(14)15-9-12(21-19-15)10-18-16(20)11-5-1-2-6-11/h1-9,11H,10H2,(H,18,20) |
| InChIKey | HCFAXALSJBVZSA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.29 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide?
The IUPAC name of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide (CID 130347890) is N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide.
What is the SMILES notation for N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide?
The canonical SMILES for N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide is O=C(NCc1cc(-c2ccccc2F)no1)C1C=CC=C1.
What is the InChIKey of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide?
The InChIKey is HCFAXALSJBVZSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13FN2O2/c17-14-8-4-3-7-13(14)15-9-12(21-19-15)10-18-16(20)11-5-1-2-6-11/h1-9,11H,10H2,(H,18,20).
What are the key properties of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide?
N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide has a molecular weight of 284.29 g/mol, XLogP of 2.84, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]cyclopenta-2,4-diene-1-carboxamide is sourced from PubChem (CID 130347890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).