About N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide
N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide (PubChem CID 118788523) has the molecular formula C19H24FN3O3
and a molecular weight of 361.42 g/mol. Its IUPAC name is N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide.
Molecular Properties
| Compound Name | N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide |
| PubChem CID | 118788523 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide |
| SMILES | CC(C)N1CCOC(CC(=O)NCc2cc(-c3ccccc3F)no2)C1 |
| InChI | InChI=1S/C19H24FN3O3/c1-13(2)23-7-8-25-15(12-23)10-19(24)21-11-14-9-18(22-26-14)16-5-3-4-6-17(16)20/h3-6,9,13,15H,7-8,10-12H2,1-2H3,(H,21,24) |
| InChIKey | CRTRTCWWZQLXJM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide?
The IUPAC name of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide (CID 118788523) is N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide.
What is the SMILES notation for N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide?
The canonical SMILES for N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide is CC(C)N1CCOC(CC(=O)NCc2cc(-c3ccccc3F)no2)C1.
What is the InChIKey of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide?
The InChIKey is CRTRTCWWZQLXJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24FN3O3/c1-13(2)23-7-8-25-15(12-23)10-19(24)21-11-14-9-18(22-26-14)16-5-3-4-6-17(16)20/h3-6,9,13,15H,7-8,10-12H2,1-2H3,(H,21,24).
What are the key properties of N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide?
N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide has a molecular weight of 361.42 g/mol, XLogP of 2.60, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-(4-propan-2-ylmorpholin-2-yl)acetamide is sourced from PubChem (CID 118788523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).