C21H20FN3O3 — CID 131889703
N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-morpholin-4-ylbenzamide (PubChem CID 131889703) has the molecular formula C21H20FN3O3 and a molecular weight of 381.41 g/mol. Its IUPAC name is N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-morpholin-4-ylbenzamide.
| Compound Name | N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-morpholin-4-ylbenzamide |
|---|---|
| PubChem CID | 131889703 |
| Molecular Formula | C21H20FN3O3 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[[3-(2-fluorophenyl)-1,2-oxazol-5-yl]methyl]-2-morpholin-4-ylbenzamide |
| SMILES | O=C(NCc1cc(-c2ccccc2F)no1)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C21H20FN3O3/c22-18-7-3-1-5-16(18)19-13-15(28-24-19)14-23-21(26)17-6-2-4-8-20(17)25-9-11-27-12-10-25/h1-8,13H,9-12,14H2,(H,23,26) |
| InChIKey | SSGTWKKGRPULCE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |