C16H21N3O2 — CID 145111341
3-(aminomethyl)-N-methylcyclobutan-1-amine;3-phenyl-1,2-oxazole-5-carbaldehyde (PubChem CID 145111341) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-(aminomethyl)-N-methylcyclobutan-1-amine;3-phenyl-1,2-oxazole-5-carbaldehyde.
| Compound Name | 3-(aminomethyl)-N-methylcyclobutan-1-amine;3-phenyl-1,2-oxazole-5-carbaldehyde |
|---|---|
| PubChem CID | 145111341 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 3-(aminomethyl)-N-methylcyclobutan-1-amine;3-phenyl-1,2-oxazole-5-carbaldehyde |
| SMILES | CNC1CC(CN)C1.O=Cc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C10H7NO2.C6H14N2/c12-7-9-6-10(11-13-9)8-4-2-1-3-5-8;1-8-6-2-5(3-6)4-7/h1-7H;5-6,8H,2-4,7H2,1H3 |
| InChIKey | PIKKNPQXXWONHC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|