C23H28N2OSi — CID 13333693
(Z)-N-[tert-butyl(dimethyl)silyl]-1-phenyl-2-(3-phenyl-1,2-oxazol-5-yl)ethenamine (PubChem CID 13333693) has the molecular formula C23H28N2OSi and a molecular weight of 376.58 g/mol. Its IUPAC name is (Z)-N-[tert-butyl(dimethyl)silyl]-1-phenyl-2-(3-phenyl-1,2-oxazol-5-yl)ethenamine.
| Compound Name | (Z)-N-[tert-butyl(dimethyl)silyl]-1-phenyl-2-(3-phenyl-1,2-oxazol-5-yl)ethenamine |
|---|---|
| PubChem CID | 13333693 |
| Molecular Formula | C23H28N2OSi |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | (Z)-N-[tert-butyl(dimethyl)silyl]-1-phenyl-2-(3-phenyl-1,2-oxazol-5-yl)ethenamine |
| SMILES | CC(C)(C)[Si](C)(C)N/C(=C\c1cc(-c2ccccc2)no1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2OSi/c1-23(2,3)27(4,5)25-22(19-14-10-7-11-15-19)17-20-16-21(24-26-20)18-12-8-6-9-13-18/h6-17,25H,1-5H3/b22-17- |
| InChIKey | URZKQINABTXGBH-XLNRJJMWSA-N |
| XLogP | 6.43 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|