About 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine
1-(3-phenyl-1,2-oxazol-5-yl)ethenamine (PubChem CID 143747120) has the molecular formula C11H10N2O
and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine.
Molecular Properties
| Compound Name | 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine |
| PubChem CID | 143747120 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine |
| SMILES | C=C(N)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C11H10N2O/c1-8(12)11-7-10(13-14-11)9-5-3-2-4-6-9/h2-7H,1,12H2 |
| InChIKey | AFTFRRFTDDKFNR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine?
The IUPAC name of 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine (CID 143747120) is 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine.
What is the SMILES notation for 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine?
The canonical SMILES for 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine is C=C(N)c1cc(-c2ccccc2)no1.
What is the InChIKey of 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine?
The InChIKey is AFTFRRFTDDKFNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O/c1-8(12)11-7-10(13-14-11)9-5-3-2-4-6-9/h2-7H,1,12H2.
What are the key properties of 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine?
1-(3-phenyl-1,2-oxazol-5-yl)ethenamine has a molecular weight of 186.21 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine is sourced from PubChem (CID 143747120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).