C11H10N2O — CID 143747120
1-(3-phenyl-1,2-oxazol-5-yl)ethenamine (PubChem CID 143747120) has the molecular formula C11H10N2O and a molecular weight of 186.21 g/mol. Its IUPAC name is 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine.
| Compound Name | 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine |
|---|---|
| PubChem CID | 143747120 |
| Molecular Formula | C11H10N2O |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.08 |
| IUPAC Name | 1-(3-phenyl-1,2-oxazol-5-yl)ethenamine |
| SMILES | C=C(N)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C11H10N2O/c1-8(12)11-7-10(13-14-11)9-5-3-2-4-6-9/h2-7H,1,12H2 |
| InChIKey | AFTFRRFTDDKFNR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |