C15H15NO4 — CID 58032908
ethyl 3-oxo-4-(3-phenyl-1,2-oxazol-5-yl)butanoate (PubChem CID 58032908) has the molecular formula C15H15NO4 and a molecular weight of 273.29 g/mol. Its IUPAC name is ethyl 3-oxo-4-(3-phenyl-1,2-oxazol-5-yl)butanoate.
| Compound Name | ethyl 3-oxo-4-(3-phenyl-1,2-oxazol-5-yl)butanoate |
|---|---|
| PubChem CID | 58032908 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | ethyl 3-oxo-4-(3-phenyl-1,2-oxazol-5-yl)butanoate |
| SMILES | CCOC(=O)CC(=O)Cc1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C15H15NO4/c1-2-19-15(18)9-12(17)8-13-10-14(16-20-13)11-6-4-3-5-7-11/h3-7,10H,2,8-9H2,1H3 |
| InChIKey | CYQDSQRCLHIZGN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|