C14H15FN2O — CID 170765884
3-(4-fluorophenyl)-5-piperidin-4-yl-1,2-oxazole (PubChem CID 170765884) has the molecular formula C14H15FN2O and a molecular weight of 246.28 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-5-piperidin-4-yl-1,2-oxazole.
| Compound Name | 3-(4-fluorophenyl)-5-piperidin-4-yl-1,2-oxazole |
|---|---|
| PubChem CID | 170765884 |
| Molecular Formula | C14H15FN2O |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-(4-fluorophenyl)-5-piperidin-4-yl-1,2-oxazole |
| SMILES | Fc1ccc(-c2cc(C3CCNCC3)on2)cc1 |
| InChI | InChI=1S/C14H15FN2O/c15-12-3-1-10(2-4-12)13-9-14(18-17-13)11-5-7-16-8-6-11/h1-4,9,11,16H,5-8H2 |
| InChIKey | XOMMRTWHOBUXLQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |