C13H13FN2O — CID 69491718
3-(3-fluorophenyl)-5-[(2R)-pyrrolidin-2-yl]-1,2-oxazole (PubChem CID 69491718) has the molecular formula C13H13FN2O and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-(3-fluorophenyl)-5-[(2R)-pyrrolidin-2-yl]-1,2-oxazole.
| Compound Name | 3-(3-fluorophenyl)-5-[(2R)-pyrrolidin-2-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 69491718 |
| Molecular Formula | C13H13FN2O |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 3-(3-fluorophenyl)-5-[(2R)-pyrrolidin-2-yl]-1,2-oxazole |
| SMILES | Fc1cccc(-c2cc([C@H]3CCCN3)on2)c1 |
| InChI | InChI=1S/C13H13FN2O/c14-10-4-1-3-9(7-10)12-8-13(17-16-12)11-5-2-6-15-11/h1,3-4,7-8,11,15H,2,5-6H2/t11-/m1/s1 |
| InChIKey | GZKONVGTJBGFKN-LLVKDONJSA-N |
| XLogP | 2.91 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |