C32H25N7O — CID 46939289
4-N,6-N-diphenyl-2-N-[4-[5-[(E)-2-phenylethenyl]-1,2-oxazol-3-yl]phenyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 46939289) has the molecular formula C32H25N7O and a molecular weight of 523.60 g/mol. Its IUPAC name is 4-N,6-N-diphenyl-2-N-[4-[5-[(E)-2-phenylethenyl]-1,2-oxazol-3-yl]phenyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-diphenyl-2-N-[4-[5-[(E)-2-phenylethenyl]-1,2-oxazol-3-yl]phenyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 46939289 |
| Molecular Formula | C32H25N7O |
| Molecular Weight | 523.60 g/mol |
| Exact Mass | 523.21 |
| IUPAC Name | 4-N,6-N-diphenyl-2-N-[4-[5-[(E)-2-phenylethenyl]-1,2-oxazol-3-yl]phenyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | C(=C/c1cc(-c2ccc(Nc3nc(Nc4ccccc4)nc(Nc4ccccc4)n3)cc2)no1)\c1ccccc1 |
| InChI | InChI=1S/C32H25N7O/c1-4-10-23(11-5-1)16-21-28-22-29(39-40-28)24-17-19-27(20-18-24)35-32-37-30(33-25-12-6-2-7-13-25)36-31(38-32)34-26-14-8-3-9-15-26/h1-22H,(H3,33,34,35,36,37,38)/b21-16+ |
| InChIKey | MVYDGRUVNSAHFI-LTGZKZEYSA-N |
| XLogP | 7.93 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.60 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |