C38H40N12O2 — CID 66838275
2-[[4-anilino-6-[4-[2-[4-[[4-anilino-6-[2-hydroxyethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]phenyl]ethenyl]anilino]-1,3,5-triazin-2-yl]-methylamino]ethanol (PubChem CID 66838275) has the molecular formula C38H40N12O2 and a molecular weight of 696.82 g/mol. Its IUPAC name is 2-[[4-anilino-6-[4-[2-[4-[[4-anilino-6-[2-hydroxyethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]phenyl]ethenyl]anilino]-1,3,5-triazin-2-yl]-methylamino]ethanol.
| Compound Name | 2-[[4-anilino-6-[4-[2-[4-[[4-anilino-6-[2-hydroxyethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]phenyl]ethenyl]anilino]-1,3,5-triazin-2-yl]-methylamino]ethanol |
|---|---|
| PubChem CID | 66838275 |
| Molecular Formula | C38H40N12O2 |
| Molecular Weight | 696.82 g/mol |
| Exact Mass | 696.34 |
| IUPAC Name | 2-[[4-anilino-6-[4-[2-[4-[[4-anilino-6-[2-hydroxyethyl(methyl)amino]-1,3,5-triazin-2-yl]amino]phenyl]ethenyl]anilino]-1,3,5-triazin-2-yl]-methylamino]ethanol |
| SMILES | CN(CCO)c1nc(Nc2ccccc2)nc(Nc2ccc(C=Cc3ccc(Nc4nc(Nc5ccccc5)nc(N(C)CCO)n4)cc3)cc2)n1 |
| InChI | InChI=1S/C38H40N12O2/c1-49(23-25-51)37-45-33(39-29-9-5-3-6-10-29)43-35(47-37)41-31-19-15-27(16-20-31)13-14-28-17-21-32(22-18-28)42-36-44-34(40-30-11-7-4-8-12-30)46-38(48-36)50(2)24-26-52/h3-22,51-52H,23-26H2,1-2H3,(H2,39,41,43,45,47)(H2,40,42,44,46,48) |
| InChIKey | JMLNEXHTCUNIAQ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 172.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.82 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|