C10H8BrF — CID 169084870
2-bromo-1-[(1E)-buta-1,3-dienyl]-4-fluorobenzene (PubChem CID 169084870) has the molecular formula C10H8BrF and a molecular weight of 227.08 g/mol. Its IUPAC name is 2-bromo-1-[(1E)-buta-1,3-dienyl]-4-fluorobenzene.
| Compound Name | 2-bromo-1-[(1E)-buta-1,3-dienyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 169084870 |
| Molecular Formula | C10H8BrF |
| Molecular Weight | 227.08 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | 2-bromo-1-[(1E)-buta-1,3-dienyl]-4-fluorobenzene |
| SMILES | C=C/C=C/c1ccc(F)cc1Br |
| InChI | InChI=1S/C10H8BrF/c1-2-3-4-8-5-6-9(12)7-10(8)11/h2-7H,1H2/b4-3+ |
| InChIKey | QMKLADIWSBIQFQ-ONEGZZNKSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.08 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|