(2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid

C11H8F2O2 — CID 116865813

IUPAC(2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid
SMILESO=C(O)/C=C/C=C/c1ccc(F)cc1F
InChIInChI=1S/C11H8F2O2/c12-9-6-5-8(10(13)7-9)3-1-2-4-11(14)15/h1-7H,(H,14,15)/b3-1+,4-2+
InChIKeyRZQJYEBPFZNQCQ-ZPUQHVIOSA-N
MW210.18 g/mol
LogP2.62
Rot. Bonds3

About (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid

(2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid (PubChem CID 116865813) has the molecular formula C11H8F2O2 and a molecular weight of 210.18 g/mol. Its IUPAC name is (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid.

Molecular Properties

Compound Name(2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid
PubChem CID116865813
Molecular FormulaC11H8F2O2
Molecular Weight210.18 g/mol
Exact Mass210.05
IUPAC Name(2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid
SMILESO=C(O)/C=C/C=C/c1ccc(F)cc1F
InChIInChI=1S/C11H8F2O2/c12-9-6-5-8(10(13)7-9)3-1-2-4-11(14)15/h1-7H,(H,14,15)/b3-1+,4-2+
InChIKeyRZQJYEBPFZNQCQ-ZPUQHVIOSA-N
XLogP2.62
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.18
LogP ≤ 52.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid?
The IUPAC name of (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid (CID 116865813) is (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid.
What is the SMILES notation for (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid?
The canonical SMILES for (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid is O=C(O)/C=C/C=C/c1ccc(F)cc1F.
What is the InChIKey of (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid?
The InChIKey is RZQJYEBPFZNQCQ-ZPUQHVIOSA-N. The full InChI is InChI=1S/C11H8F2O2/c12-9-6-5-8(10(13)7-9)3-1-2-4-11(14)15/h1-7H,(H,14,15)/b3-1+,4-2+.
What are the key properties of (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid?
(2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid has a molecular weight of 210.18 g/mol, XLogP of 2.62, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-5-(2,4-difluorophenyl)penta-2,4-dienoic acid is sourced from PubChem (CID 116865813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).