C17H10F4O — CID 68697765
1,5-bis(2,4-difluorophenyl)penta-1,4-dien-3-one (PubChem CID 68697765) has the molecular formula C17H10F4O and a molecular weight of 306.26 g/mol. Its IUPAC name is 1,5-bis(2,4-difluorophenyl)penta-1,4-dien-3-one.
| Compound Name | 1,5-bis(2,4-difluorophenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 68697765 |
| Molecular Formula | C17H10F4O |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1,5-bis(2,4-difluorophenyl)penta-1,4-dien-3-one |
| SMILES | O=C(C=Cc1ccc(F)cc1F)C=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C17H10F4O/c18-13-5-1-11(16(20)9-13)3-7-15(22)8-4-12-2-6-14(19)10-17(12)21/h1-10H |
| InChIKey | FJOWYNWCEUBVTE-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|