C9H8F2OS — CID 67288123
2,4-difluoro-1-(2-methylsulfinylethenyl)benzene (PubChem CID 67288123) has the molecular formula C9H8F2OS and a molecular weight of 202.22 g/mol. Its IUPAC name is 2,4-difluoro-1-(2-methylsulfinylethenyl)benzene.
| Compound Name | 2,4-difluoro-1-(2-methylsulfinylethenyl)benzene |
|---|---|
| PubChem CID | 67288123 |
| Molecular Formula | C9H8F2OS |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 2,4-difluoro-1-(2-methylsulfinylethenyl)benzene |
| SMILES | CS(=O)C=Cc1ccc(F)cc1F |
| InChI | InChI=1S/C9H8F2OS/c1-13(12)5-4-7-2-3-8(10)6-9(7)11/h2-6H,1H3 |
| InChIKey | ALMWTTNSKBDCFL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |