3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid

C16H12F2O3 — CID 76936525

IUPAC3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid
SMILESCc1cc(Oc2ccc(F)cc2F)ccc1C=CC(=O)O
InChIInChI=1S/C16H12F2O3/c1-10-8-13(5-2-11(10)3-7-16(19)20)21-15-6-4-12(17)9-14(15)18/h2-9H,1H3,(H,19,20)
InChIKeyOTDYYVBBJGEZAG-UHFFFAOYSA-N
MW290.27 g/mol
LogP4.16
Rot. Bonds4

About 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid

3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid (PubChem CID 76936525) has the molecular formula C16H12F2O3 and a molecular weight of 290.27 g/mol. Its IUPAC name is 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid.

Molecular Properties

Compound Name3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid
PubChem CID76936525
Molecular FormulaC16H12F2O3
Molecular Weight290.27 g/mol
Exact Mass290.08
IUPAC Name3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid
SMILESCc1cc(Oc2ccc(F)cc2F)ccc1C=CC(=O)O
InChIInChI=1S/C16H12F2O3/c1-10-8-13(5-2-11(10)3-7-16(19)20)21-15-6-4-12(17)9-14(15)18/h2-9H,1H3,(H,19,20)
InChIKeyOTDYYVBBJGEZAG-UHFFFAOYSA-N
XLogP4.16
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500290.27
LogP ≤ 54.16
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid?
The IUPAC name of 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid (CID 76936525) is 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid.
What is the SMILES notation for 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid?
The canonical SMILES for 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid is Cc1cc(Oc2ccc(F)cc2F)ccc1C=CC(=O)O.
What is the InChIKey of 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid?
The InChIKey is OTDYYVBBJGEZAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12F2O3/c1-10-8-13(5-2-11(10)3-7-16(19)20)21-15-6-4-12(17)9-14(15)18/h2-9H,1H3,(H,19,20).
What are the key properties of 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid?
3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid has a molecular weight of 290.27 g/mol, XLogP of 4.16, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid is sourced from PubChem (CID 76936525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).