C16H12F2O3 — CID 76936525
3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid (PubChem CID 76936525) has the molecular formula C16H12F2O3 and a molecular weight of 290.27 g/mol. Its IUPAC name is 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76936525 |
| Molecular Formula | C16H12F2O3 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | 3-[4-(2,4-difluorophenoxy)-2-methylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(Oc2ccc(F)cc2F)ccc1C=CC(=O)O |
| InChI | InChI=1S/C16H12F2O3/c1-10-8-13(5-2-11(10)3-7-16(19)20)21-15-6-4-12(17)9-14(15)18/h2-9H,1H3,(H,19,20) |
| InChIKey | OTDYYVBBJGEZAG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|