About bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid
bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid (PubChem CID 66622824) has the molecular formula C17H19FO2
and a molecular weight of 274.34 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid |
| PubChem CID | 66622824 |
| Molecular Formula | C17H19FO2 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid |
| SMILES | C1=CC2CCC1C2.Cc1cc(F)ccc1C=CC(=O)O |
| InChI | InChI=1S/C10H9FO2.C7H10/c1-7-6-9(11)4-2-8(7)3-5-10(12)13;1-2-7-4-3-6(1)5-7/h2-6H,1H3,(H,12,13);1-2,6-7H,3-5H2 |
| InChIKey | XYCAWCZLQZSUAY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid?
The IUPAC name of bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid (CID 66622824) is bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid.
What is the SMILES notation for bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid?
The canonical SMILES for bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid is C1=CC2CCC1C2.Cc1cc(F)ccc1C=CC(=O)O.
What is the InChIKey of bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid?
The InChIKey is XYCAWCZLQZSUAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO2.C7H10/c1-7-6-9(11)4-2-8(7)3-5-10(12)13;1-2-7-4-3-6(1)5-7/h2-6H,1H3,(H,12,13);1-2,6-7H,3-5H2.
What are the key properties of bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid?
bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid has a molecular weight of 274.34 g/mol, XLogP of 4.20, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-2-ene;3-(4-fluoro-2-methylphenyl)prop-2-enoic acid is sourced from PubChem (CID 66622824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).