C18H22O3 — CID 66622770
bicyclo[2.2.1]hept-2-ene;3-(5-methoxy-2-methylphenyl)prop-2-enoic acid (PubChem CID 66622770) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-2-ene;3-(5-methoxy-2-methylphenyl)prop-2-enoic acid.
| Compound Name | bicyclo[2.2.1]hept-2-ene;3-(5-methoxy-2-methylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 66622770 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene;3-(5-methoxy-2-methylphenyl)prop-2-enoic acid |
| SMILES | C1=CC2CCC1C2.COc1ccc(C)c(C=CC(=O)O)c1 |
| InChI | InChI=1S/C11H12O3.C7H10/c1-8-3-5-10(14-2)7-9(8)4-6-11(12)13;1-2-7-4-3-6(1)5-7/h3-7H,1-2H3,(H,12,13);1-2,6-7H,3-5H2 |
| InChIKey | SUWOUORSOCJFEY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|