C16H16N6S — CID 18529381
1-(1H-benzimidazol-2-yl)-3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]thiourea (PubChem CID 18529381) has the molecular formula C16H16N6S and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]thiourea.
| Compound Name | 1-(1H-benzimidazol-2-yl)-3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]thiourea |
|---|---|
| PubChem CID | 18529381 |
| Molecular Formula | C16H16N6S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-3-[4-[(1Z)-buta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]thiourea |
| SMILES | C=C/C=C\c1nc(NC(=S)Nc2nc3ccccc3[nH]2)[nH]c1C |
| InChI | InChI=1S/C16H16N6S/c1-3-4-7-11-10(2)17-14(18-11)21-16(23)22-15-19-12-8-5-6-9-13(12)20-15/h3-9H,1H2,2H3,(H4,17,18,19,20,21,22,23)/b7-4- |
| InChIKey | CZEHICHSNSBEQF-DAXSKMNVSA-N |
| XLogP | 3.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|