C17H16N4S — CID 57209217
1-(1H-benzimidazol-2-yl)-3-(1-phenylcyclopropyl)thiourea (PubChem CID 57209217) has the molecular formula C17H16N4S and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-(1H-benzimidazol-2-yl)-3-(1-phenylcyclopropyl)thiourea.
| Compound Name | 1-(1H-benzimidazol-2-yl)-3-(1-phenylcyclopropyl)thiourea |
|---|---|
| PubChem CID | 57209217 |
| Molecular Formula | C17H16N4S |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-(1H-benzimidazol-2-yl)-3-(1-phenylcyclopropyl)thiourea |
| SMILES | S=C(Nc1nc2ccccc2[nH]1)NC1(c2ccccc2)CC1 |
| InChI | InChI=1S/C17H16N4S/c22-16(20-15-18-13-8-4-5-9-14(13)19-15)21-17(10-11-17)12-6-2-1-3-7-12/h1-9H,10-11H2,(H3,18,19,20,21,22) |
| InChIKey | RLVZLGKCVWTSQN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|